molweight {marelac} | R Documentation |
Calculates the molecular weight of chemical species.
molweight(species)
species |
character vector with chemical species whose molecular weight is requested. |
Molecular weights of chemical elements may vary due to different isotope compositions, depending on geology, industrial processes or biological activity. Please consult the IUPAC Technical report about the details. The function returns NA for elements (and their compounds) which have no stable isotopes (except U, Th, Pa).
Vector with the molecular weights in g/mol.
This function uses text parsing of chemical formulae, it is strictly case sensitive.
Thomas Petzoldt
Wieser ME, 2006. Atomic weights of the elements 2005 (IUPAC Technical Report). Pure Appl. Chem. 78(11), 2051–2066. doi:10.1351/pac200678112051
AtomicWeight
, molvol
,
redfield
molweight("CO2") molweight("HCO3") molweight("H") molweight("H3PO4") ## eicosapentaenoic acid (EPA) molweight("CH3CH2CHCHCH2CHCHCH2CHCHCH2CHCHCH2CHCH(CH2)3COOH") molweight("C20H30O2") ## works also with vectors molweight(c("C2H5OH", "CO2", "H2O")) molweight(c("SiOH4", "NaHCO3", "C6H12O6", "Ca(HCO3)2", "Pb(NO3)2", "(NH4)2SO4")) ## note that chemical formulae are case-sensitive molweight("Co") # cobalt molweight("CO") # carbon monoxide ## from gram to mol 1/molweight("CO3")